PRN 97-5 Appendix A
Common Name for use on pesticide Labels approved by The American National Standards Institute
View PR Notice 97-5- Use of Common Names for Active Ingredients on Pesticide Labeling
| Common Name |
Chemical Name |
CAS # | PC Code |
|---|---|---|---|
| Abamectin | Avermectin B21 | 71751-41-2 | 122804 |
| Acephate | O,S-Dimethyl acetylphosphoramidothioate | 30560-19-1 | 103301 |
| Acetochlor | 2'-Ethyl-6'-methyl-N-(ethoxymethyl)-2-chloroacetanilide | 34256-82-1 | 121601 |
| Acifluorfen | 5-(2-Chloro-4-(trifluoromethyl)phenoxy)-2-nitrobenzoic acid | 50594-66-6 | 114401 |
| Alachlor | 2-Chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide | 15972-60-8 | 090501 |
| Aldicarb | 2-Methyl-2-(methylthio)propionaldehyde O-(methylcarbamoyl)oxime | 116-06-3 | 098301 |
| Aldoxycarb | 2-Methyl-2-(methylsulfonyl)propanal O-((methylamino)carbonyl)oxime | 1646-88-4 | 110801 |
| Ametryn | 2-(Ethylamino)-4-(isopropylamino)-6-(methylthio)-s-triazine | 834-12-8 | 080801 |
| Amitraz | N'-(2,4-Dimethylphenyl)-N-(((2,4-dimethylphenyl)imino)methyl)-N-methylmethanimidamide | 33089-61-1 | 106201 |
| Amitrole | 3-Amino-s-triazole | 61-82-5 | 004401 |
| Ancymidol | Cyclopropyl-(4-methoxyphenyl)-5-pyrimidinemethanol | 12771-68-5 | 108601 |
| Asulam | Methyl sulfanilylcarbamate | 3337-71-1 | 106901 |
| Atrazine | 2-Chloro-4-(ethylamino)-6-(isopropylamino)-s-triazine | 1912-24-9 | 080803 |
| Bendiocarb | 2,2-dimethyl-1,3-benzoldioxol-4-yl methylcarbamate | 22781-23-3 | 105201 |
| Benomyl | Methyl 1-(butylcarbamoyl)-2-benzimidazolecarbamate | 17804-35-2 | 099101 |
| Bensulfuron | Methyl 2-((((((4,6-dimethoxy-2-pyrimidinyl)amino)carbonyl)amino) sulfonyl)methyl)benzoate | 83055-99-6 | 128820 |
| Bentazon | 3-Isopropyl-1H-2,1,3-benzothiadiazin-4(3H)-one-2,2-dioxide | 25057-89-0 | 275200 |
| Bifenthrin 83322-02-5 | (2-Methyl{1,1'-biphenyl}-3-yl)methyl 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylate, (Z) | 82657-04-3 | 128825 |
| Brodifacoum | 3-(3-(4'-(Bromo-(1,1-biphenyl)-4-yl)-1,2,4,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin | 56073-10-0 | 112701 |
| Bromacil | 5-Bromo-3-sec-butyl-6-methyluracil | 314-40-9 | 012301 |
| Bromethalin | N-Methyl-2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl) benzenamine | 63333-35-7 | 112802 |
| Bromoxynil | 3,5-Dibromo-4-hydroxybenzonitrile | 1689-84-5 | 035301 |
| Butralin | 4-(1,1-Dimethylethyl)-N-(1-methylpropyl)-2,6-dinitrobenzenamine | 33629-47-9 | 106501 |
| Carbaryl | 1-Naphthyl-N-methylcarbamate | 63-25-2 | 056801 |
| Carbofuran | 2,3-Dihydro-2,2-dimethyl-7-benzofuranyl methylcarbamate | 1563-66-2 | 090601 |
| Carboxin | 5,6-Dihydro-2-methyl-1,4-oxathiin-3-carboxanalide | 5234-68-4 | 090201 |
| Chlorethoxyfos | O,O-Diethyl O-(1,2,2,2-tetrachloroethyl) phosphorothioate | 54593-83-8 | 129006 |
| Chlorimuron | Benzoic acid, 2-[[[[(4-chloro-6-methoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-, ethyl ester | 90982-32-4 | 128901 |
| Chloroneb | 1,4-Dichloro-2,5-dimethoxybenzene | 2675-77-6 | 027301 |
| Chlorothalonil | Tetrachloroisophthalonitrile | 1897-45-6 | 081901 |
| Chlorpyrifos | O,O-Diethyl O-(3,5,6-trichloro-2-pyridyl) phosphorothioate | 2921-88-2 | 059101 |
| Chlorpyrifos-Methyl | O,O-Dimethyl O-(3,5,6-trichloro-2-pyridyl) phosphorothioate | 5598-13-0 | 059102 |
| Chlorsulfuron | Benzenesulfonamide, 2-chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]- | 64902-72-3 | 118601 |
| Clethodim | 2-Cyclohexen-1-one, 2-(1-(((3-chloro-2-propenyl)oxy)imino)propyl)-5-(2-(ethylthio)propyl)-3-hydroxy- | 99129-21-2 | 121011 |
| Clofencet | 4-Pyridazinecarboxylic acid, 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-, potassium salt | 82697-71-0 | 128726 |
| Clofentezine | 3,6-Bis(2-chlorophenyl)-1,2,4,5-tetrazine | 74115-24-5 | 125501 |
| Clomazone | 2-(2-Chlorophenyl)methyl-4,4-dimethyl-3-isoxazolidinone | 81777-89-1 | 125401 |
| Clopyralid | 3,6-Dichloropicolinic acid | 1702-17-6 | 117403 |
| Cypermethrin | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-,cyano(3-phenoxyphenyl)methyl ester | 52315-07-8 | 109702 |
| Zeta-Cypermethrin | S-Cyano(3-phenoxyphenyl)methyl (+/-)-cis/trans-3-(2,2-dichloethenyl)-2,2-dimethylcyclopropanecarboxylate | None | 129064 |
| Cyromazine | N-Cyclopropyl-1,3,5-triazine-2,4,6-triamine | 66215-27-8 | 121301 |
| Daminozide | Butanedioic acid mono(2,2-dimethylhydrazide) | 1596-84-5 | 035101 |
| Desmedipham | Ethyl m-hydroxycarbanilate carbanilate | 13684-56-5 | 104801 |
| Diazinon | O,O-Diethyl O-(2-isopropyl-6-methyl-4-pyrimidinyl)phosphorothioate | 333-41-5 | 057801 |
| Dicamba | 3,6-Dichloro-o-anisic acid | 1918-00-9 | 029801 |
| Dichlobenil | 2,6-Dichlorobenzonitrile | 1194-65-6 | 027401 |
| Diclofop | 2-(4-(2,4-Dichlorophenoxy)phenoxy)propanoic acid | 40843-25-2 | 110901 |
| Difenzoquat | 1H-Pyrazolium, 1,2-dimethyl-3,5-diphenyl- | 49866-87-7 | 106402 |
| Diflubenzuron | 1-(4-Chlorophenyl)-3-(2,6-difluorobenzoyl)urea | 35367-38-5 | 108201 |
| Dikegulac | 2,3:4,6-Bis-O-(1-methylethylidene)-L-xylo-2-hexulofuranosonic acid,sodium salt | 52508-35-7 | 109601 |
| Dimethipin | 2,3-Dihydro-5,6-dimethyl-1,4-dithiin-1,1,4,4-tetraoxide | 55290-64-7 | 118901 |
| Dimethoate | O,O-Dimethyl S-((methylcarbamoyl)methyl) phosphorodithioate | 60-51-5 | 035001 |
| Diphacinone | 2-(Diphenylacetyl)-1,3-indandione | 82-66-6 | 067701 |
| Diquat | Diquat ion | 2764-72-9 | 032202 |
| Dithiopyr | 3,5-Pyridinedicarbothioic acid, 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-, S,S-dimethyl ester | 97886-45-8 | 128994 |
| Diuron | 3-(3,4-Dichlorophenyl)-1,1-dimethylurea | 330-54-1 | 035505 |
| Dodine | Dodecylguanidine acetate | 2439-10-3 | 044301 |
| Endosulfan | 6,9-Methano-2,4,3-benzodioxathiepin, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-, 3-oxide | 115-29-7 | 079401 |
| Endothall | 7-Oxabicyclo(2.2.1)heptane-2,3-dicarboxylic acid | 145-73-3 | 038901 |
| Ethalfluralin | Benzenamine, N-ethyl-N-(2-methyl-2-propen-1-yl)-2,6-dinitro-4-(trifluoromethyl)- | 55283-68-6 | 113101 |
| Ethephon | (2-Chloroethyl)phosphonic acid | 16672-87-0 | 099801 |
| Ethion | Phosphorodithioic acid, S,S'-methylene O,O,O',O'-tetraethyl ester | 563-12-2 | 058401 |
| Ethofumesate | 2-Ethoxy-2,3-dihydro-3,3-dimethyl-5-benzofuranyl methanesulfonate | 26225-79-6 | 110601 |
| Ethoprop | O-Ethyl S,S-dipropyl phosphorodithioate | 13194-48-4 | 041101 |
| Fenarimol | 5-Pyrimidinemethanol, .alpha.-(2-chlorophenyl)-.alpha.-(4-chlorophenyl)- | 60168-88-9 | 206600 |
| Fenbuconazole | 2-Cyano-2-phenyl-2-( -p-chlorophenethyl)ethyl-1H-1,2,4-triazole | 114369-43-6 | 129011 |
| Fenoxaprop | 2-(4-((6-Chloro-2-benzoxazolyl)oxy)phenoxy)propionic acid, ethyl ester | 66441-23-4 | 128701 |
| Fenoxycarb | Ethyl 2-(p-phenoxyphenoxy)ethyl carbamate | 72490-01-8 | 253011 |
| Fenpropathrin | Cyclopropanecarboxylic acid, 2,2,3,3-tetramethyl-, cyano(3-phenoxyphenyl)methyl ester | 39515-41-8 | 127901 |
| Fenridazon | Potassium 3-Pyridazinecarboxylic acid, 1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxo-, potassium salt | 83588-43-6 | 119001 |
| Fluazifop | Butyl 2-(4-((5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoate | 69806-50-4 | 122805 |
| Flumetsulam | (1,2,4)Triazolo(1,5-a)pyrimidine-2-sulfonamide, N-(2,6-difluorophenyl)-5-methyl- | 98967-40-9 | 129016 |
| Flumiclorac | Pentyl 2-chloro-4-fluoro-5-(3,4,5,6-tetrahydrophthalimido)phenoxyacetate | 87546-18-7 | 128724 |
| Fluometuron | 1,1-Dimethyl-3-(-trifluoro-m-tolyl)urea | 2164-17-2 | 035503 |
| Fluridone | 1-Methyl-3-phenyl-5-(3-(trifluoromethyl)phenyl)-4(1H)-pyridinone | 59756-60-4 | 112900 |
| Flurprimidol | Isopropyl-(p-(trifluoromethoxy)phenyl)-5-pyrimidinemethanol | 56425-91-3 | 125701 |
| Fluvalinate | Valine, N-[2-chloro-4-(trifluoromethyl)phenyl]-, cyano(3-phenoxyphenyl)methyl ester | 69409-94-5 | 109302 |
| Folpet | N-((Trichloromethyl)thio)phthalimide | 133-07-3 | 081601 |
| Fomesafen | Benzamide, 5-(2-chloro-4-(trifluoromethyl)phenoxy)-N-(methylsulfonyl)-2-nitro-, sodium salt | 108731-70-0 | 123802 |
| Formetanate | m-(((Dimethylamino)methylene)amino)phenyl-N-methylcarbamate | 22259-30-9 | 465200 |
| Fosamine | Ammonium ethyl carbamoylphosphonate | 25954-13-6 | 106701 |
| Glufosinate | Butanoic acid, 2-amino-4-(hydroxymethylphosphinyl)-, monoammonium salt | 77182-82-2 | 128850 |
| Glyphosate | N-(Phosphonomethyl)glycine | 1071-83-6 | 417300 |
| Hexaflumuron | Benzamide, N-[[[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]amino]carbonyl]-2,6-difluoro- | 86479-06-3 | 118202 |
| Hexazinone | 3-Cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4(1H,3H)-dione | 51235-04-2 | 107201 |
| Hydramethylnon | Tetrahydro-5,5-dimethyl-2(1H)-pyrimidinone, (3-(4-(trifluoromethyl) phenyl)-1-(2-(4-(trifluoromethyl)phenyl)ethenyl)-2-propenylidene)hydrazone | 67485-29-4 | 118401 |
| Hydroprene | Ethyl(2E,4E)-3,7,11-trimethyl-2,4-dodecadienoate | 65733-18-8 41096-46-2 |
128966 486300 |
| Imazalil | 1-(2-(2,4-Dichlorophenyl)-2-(2-propenyloxy)ethyl)-1H-imidazole | 35554-44-0 | 111901 |
| Imazamethabenz | Benzoic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-4(or 5)-methyl-, methyl ester | 81405-85-8 | 128842 |
| Imazapyr | 2-(4-Isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-nicotinic acid | 81334-34-1 | 128821 |
| Imazaquin | 3-Quinolinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]- | 81335-37-7 | 128848 |
| Imazethapyr | 3-Pyridinecarboxylic acid, 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-ethyl- | 81335-77-5 | 128922 |
| Iprodione | 1-Imidazolidinecarboxamide, 3-(3,5-dichlorophenyl)-N-(1-methylethyl)-2,4-dioxo- | 36734-19-7 | 109801 |
| Isazofos | Phosphorothioic acid, O-[5-chloro-1-(1-methylethyl)-1H-1,2,4-triazol-3-yl] O,O-diethyl ester | 42509-80-8 | 126901 |
| Isoxaben | N-(3-(1-Ethyl-1-methylpropyl)-5-isoxazolyl)-2,6-dimethoxybenzamide | 82558-50-7 | 125851 |
| Kinoprene | 2-Propynyl (E,E)-3,7,11-trimethyl-2,4-dodecadienoate | 42588-37-4 | 107501 |
| Lactofen | Benzoic acid, 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-, 2-ethoxy-1-methyl-2-oxoethyl ester | 77501-63-4 | 128888 |
| Linuron | 3-(3,4-Dichlorophenyl)-1-methoxy-1-methylurea | 330-55-2 | 035506 |
| Mefluidide | N-(2,4-Dimethyl-5-(((trifluoromethyl)sulfonyl)amino)phenyl)acetamide | 53780-34-0 | 114001 |
| Metalaxyl | N-(2,6-Dimethylphenyl)-N-(methoxyacetyl)alanine, methyl ester | 57837-19-1 | 113501 |
| Methamidophos | O,S-Dimethyl phosphoramidothioate | 10265-92-6 | 101201 |
| Methidathion | Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester | 950-37-8 | 100301 |
| Methomyl | S-Methyl N-((methylcarbamoyl)oxy)thioacetimidate | 16752-77-5 | 090301 |
| Methoprene | 2,4-Dodecadienoic acid, 11-methoxy-3,7,11-trimethyl-, 1-methylethyl ester, (2E,4E)- | 40596-69-8 | 105401 |
| Metolachlor | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)- | 51218-45-2 | 108801 |
| Metsulfuron | Methyl 2-(((((4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino)carbonyl)amino)sulfonyl)benzoate | 74223-64-6 | 122010 |
| Myclobutanil | 1H-1,2,4-Triazole-1-propanenitrile, .alpha.-butyl-.alpha.-(4-chlorophenyl)- | 88671-89-0 | 128857 |
| Naled | 1,2-Dibromo-2,2-dichloroethyl dimethyl phosphate | 300-76-5 | 034401 |
| Nicosulfuron | 2-(((((4,6-Dimethoxy-2-pyrimidinyl)amino)carbonyl)amino)sulfonyl)-N,N-dimethyl-3-pyridinecarboxamide | 111991-09-4 | 129008 |
| Nitrapyrin | 2-Chloro-6-(trichloromethyl)pyridine | 1929-82-4 | 692031 |
| Norflurazon | 4-Chloro-5-(methylamino)-2-(trifluoro-m-tolyl)-3(2H)-pyridazinone | 27314-13-2 | 105801 |
| Octhilinone | 2-Octyl-3(2H)-isothiazolone | 26530-20-1 | 099901 |
| Oryzalin | 3,5-Dinitro-N4,N4-dipropylsulfanilamide | 19044-88-3 | 104201 |
| Oxadiazon | 2-tert-Butyl-4-(2,4-dichloro-5-isopropoxyphenyl- 2-1,3,4-oxadiazoline-5-one | 19666-30-9 | 109001 |
| Oxamyl | Oxamimidic acid, N',N'-dimethyl-N-((methylcarbamoyl)oxy)-1-thio-, methyl ester | 23135-22-0 | 103801 |
| Oxycarboxin | 5,6-Dihydro-2-methyl-1,4-oxathiin-3-carboxanilide 4,4-dioxide | 5259-88-1 | 090202 |
| Oxyfluorfen | 2-Chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene | 42874-03-3 | 111601 |
| Paclobutrazol | (2RS,3RS)-1-(4-Chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pentan-3-ol | 76738-62-0 | 125601 |
| Paraquat | 4,4'-Bipyridinium, 1,1'-dimethyl- | 4685-14-7 | 061603 |
| Pendimethalin | N-(1-Ethylpropyl)-3,4-dimethyl-2,6-dinitrobenzenamine | 40487-42-1 | 108501 |
| Permethrin | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-,(3-phenoxyphenyl)methyl ester | 52645-53-1 | 109701 |
| Phenmedipham | Methyl m-hydroxycarbanilate m-methylcarbanilate | 13684-63-4 | 098701 |
| Phorate | O,O-Diethyl S-((ethylthio)methyl) phosphorodithioate | 298-02-2 | 057201 |
| Picloram | 4-Amino-3,5,6-trichloropicolinic acid | 1918-02-1 | 005101 |
| Pirimiphos-methyl | Phosphorothioic acid, O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-dimethyl ester | 29232-93-7 | 108102 |
| Prodiamine | 2,4-Dinitro-N3,N3-dipropyl-6-(trifluoromethyl)-1,3-benzenediamine | 29091-21-2 | 110201 |
| Profenofos | O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate | 41198-08-7 | 111401 |
| Prometon | 2,4-Bis(isopropylamino)-6-methoxy-s-triazine | 1610-18-0 | 080804 |
| Prometryn | 2,4-Bis(isopropylamino)-6-(methylthio)-s-triazine | 7287-19-6 | 080805 |
| Propamocarb | Propyl 3-(dimethylamino)propylcarbamate | 24579-73-5 | 119301 |
| Propargite | 2-(p-tert-Butylphenoxy)cyclohexyl 2-propynyl sulfite | 2312-35-8 | 097601 |
| Propetamphos | 2-Butenoic acid, 3-[[(ethylamino)methoxyphosphinothioyl]oxy]-, 1-methylethyl ester, (2E)- | 31218-83-4 | 113601 |
| Pyrithiobac | Sodium 2-chloro-6-(4,6-dimethoxypyrimidin-2-ylthio)benzoate | 123343-16-8 | 078905 |
| Quizalofop | Propanoic acid, 2-(4-((6-chloro-2-quinoxalinyl)oxy)phenoxy)-, ethyl ester | 76578-14-8 | 128711 |
| Resmethrin | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, [5-(phenylmethyl)-3-furanyl]methyl ester | 10453-86-8 | 097801 |
| Rimsulfuron | 2-Pyridinesulfonamide, N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-3-(ethylsulfonyl)- | 122931-48-0 | 129009 |
| Siduron | 1-(2-Methylcyclohexyl)-3-phenylurea | 1982-49-6 | 035509 |
| Simazine | 2-Chloro-4,6-bis(ethylamino)-s-triazine | 122-34-9 | 080807 |
| Sulfentrazone | Methanesulfonamide, N-[2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]- | 122836-35-5 | 129081 |
| Sulfluramid | 1-Octanesulfonamide, N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro- | 4151-50-2 | 128992 |
| Sulfometuron | Methyl 2-(((((4,6-dimethyl-2-pyrimidinyl)amino)carbonyl)amino)sulfonyl)benzoate | 74222-97-2 | 122001 |
| Tebufenozide | Benzoic acid, 3,5-dimethyl-, 1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide | 112410-23-8 | 129026 |
| Tebuthiuron | N-(5-(1,1-Dimethylethyl)-1,3,4-thiadiazol-2-yl)-N,N'-dimethylurea | 34014-18-1 | 105501 |
| Tefluthrin | Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propenyl]-2,2-dimethyl-, (2,3,5,6-tetrafluoro-4-methylphenyl)methyl ester, (1R,3R)-rel- | 79538-32-2 | 128912 |
| Temephos | Phosphorothioic acid, Op,Op'-(thiodi-4,1-phenylene) Op,Op,Op',Op'-tetramethyl ester | 3383-96-8 | 059001 |
| Terbacil | 3-tert-Butyl-5-chloro-6-methyluracil | 5902-51-2 | 012701 |
| Terbufos | S-(((1,1-Dimethylethyl)thio)methyl) O,O-diethyl phosphorodithioate | 13071-79-9 | 105001 |
| Terbuthylazine | 2-tert-Butylamino-4-chloro-6-ethylamino-s-triazine | 5915-41-3 | 080814 |
| Tetramethrin | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1,3,4,5,6,7-hexahydro-1,3-dioxo-2H-isoindol-2-yl)methyl ester | 117718-60-2 | 129100; |
| Thidiazuron | N-Phenyl-N'-(1,2,3-thiadiazyl)urea | 51707-55-2 | 120301 |
| Thifensulfuron Methyl | 2-Thiophenecarboxylic acid, 3-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]-, methyl ester | 79277-27-3 | 128845 |
| Thiodicarb | Dimethyl N,N'-(thiobis((methylimino)carbonyloxy))bis(ethanimidothioate) | 59669-26-0 | 114501 |
| Thiophanate-methyl | Dimethyl ((1,2-phenylene)bis(iminocarbonothioyl))bis(carbamate) | 23564-05-8 | 102001 |
| Tralomethrin | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(1,2,2,2-tetrabromoethyl)-, cyano(3-phenoxyphenyl)methyl ester | 66841-25-6 | 121501 |
| Tribenuron Methyl | Benzoic acid, 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methylamino]carbonyl]amino]sulfonyl]-, methyl ester | 101200-48-0 | 128887 |
| Triclopyr | 3,5,6-Trichloro-2-pyridinyloxyacetic acid | 55335-06-3 | 116001 |
| Tridiphane | 2-(3,5-Dichlorophenyl)-2-(2,2,2-trichloroethyl)oxirane | 58138-08-2 | 123901 |
| Trifluralin | Benzenamine, 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)- | 1582-09-8 | 036101 |
| Triflusulfuron | Benzoic acid, 2-(((((4-(dimethylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl)amino)carbonyl)amino)sulfonyl)-3-methyl-, methyl ester | 126535-15-7 | 129002 |
| Triforine | N,N'-(1,4-Piperazinediylbis(2,2,2-trichloroethylidine)bis(formamide) | 26644-46-2 | 107901 |
| Thiobencarb | S-((4-Chlorophenyl)methyl) N,N-diethylthiocarbamate | 28249-77-6 | 108401 |
| Uniconazole | (S-(E))-1-(4-Chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)-pent-1-ene-3-ol | 83657-17-4 | 128976 |